C17H22IN3O — CID 97252413
(1R)-1-(1-ethylimidazol-2-yl)-1-(4-iodophenyl)-N-[[(3R)-oxolan-3-yl]methyl]methanamine (PubChem CID 97252413) has the molecular formula C17H22IN3O and a molecular weight of 411.29 g/mol. Its IUPAC name is (1R)-1-(1-ethylimidazol-2-yl)-1-(4-iodophenyl)-N-[[(3R)-oxolan-3-yl]methyl]methanamine.
| Compound Name | (1R)-1-(1-ethylimidazol-2-yl)-1-(4-iodophenyl)-N-[[(3R)-oxolan-3-yl]methyl]methanamine |
|---|---|
| PubChem CID | 97252413 |
| Molecular Formula | C17H22IN3O |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | (1R)-1-(1-ethylimidazol-2-yl)-1-(4-iodophenyl)-N-[[(3R)-oxolan-3-yl]methyl]methanamine |
| SMILES | CCn1ccnc1[C@H](NC[C@H]1CCOC1)c1ccc(I)cc1 |
| InChI | InChI=1S/C17H22IN3O/c1-2-21-9-8-19-17(21)16(14-3-5-15(18)6-4-14)20-11-13-7-10-22-12-13/h3-6,8-9,13,16,20H,2,7,10-12H2,1H3/t13-,16-/m1/s1 |
| InChIKey | MMYRFVCGRLJOSE-CZUORRHYSA-N |
| XLogP | 3.22 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|