C17H23N3O4S — CID 97253454
methyl (3S)-3-[[2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl]amino]thiolane-3-carboxylate (PubChem CID 97253454) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is methyl (3S)-3-[[2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl]amino]thiolane-3-carboxylate.
| Compound Name | methyl (3S)-3-[[2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl]amino]thiolane-3-carboxylate |
|---|---|
| PubChem CID | 97253454 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | methyl (3S)-3-[[2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl]amino]thiolane-3-carboxylate |
| SMILES | CCNC(=O)c1cccc(NC(=O)CN[C@]2(C(=O)OC)CCSC2)c1 |
| InChI | InChI=1S/C17H23N3O4S/c1-3-18-15(22)12-5-4-6-13(9-12)20-14(21)10-19-17(16(23)24-2)7-8-25-11-17/h4-6,9,19H,3,7-8,10-11H2,1-2H3,(H,18,22)(H,20,21)/t17-/m1/s1 |
| InChIKey | XWCOWQFZUMXBLY-QGZVFWFLSA-N |
| XLogP | 1.01 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |