C14H21NO4 — CID 97254551
N-[(3R)-3-hydroxy-2-methylbutan-2-yl]-2,3-dimethoxybenzamide (PubChem CID 97254551) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is N-[(3R)-3-hydroxy-2-methylbutan-2-yl]-2,3-dimethoxybenzamide.
| Compound Name | N-[(3R)-3-hydroxy-2-methylbutan-2-yl]-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 97254551 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | N-[(3R)-3-hydroxy-2-methylbutan-2-yl]-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)NC(C)(C)[C@@H](C)O)c1OC |
| InChI | InChI=1S/C14H21NO4/c1-9(16)14(2,3)15-13(17)10-7-6-8-11(18-4)12(10)19-5/h6-9,16H,1-5H3,(H,15,17)/t9-/m1/s1 |
| InChIKey | ULDAYWBYXWMZSY-SECBINFHSA-N |
| XLogP | 1.59 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |