C19H21FN2O2 — CID 97255039
N-[(2-fluorophenyl)methyl]-3-[[(2S,3S)-2-methyloxolan-3-yl]amino]benzamide (PubChem CID 97255039) has the molecular formula C19H21FN2O2 and a molecular weight of 328.39 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-3-[[(2S,3S)-2-methyloxolan-3-yl]amino]benzamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-3-[[(2S,3S)-2-methyloxolan-3-yl]amino]benzamide |
|---|---|
| PubChem CID | 97255039 |
| Molecular Formula | C19H21FN2O2 |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-3-[[(2S,3S)-2-methyloxolan-3-yl]amino]benzamide |
| SMILES | C[C@@H]1OCC[C@@H]1Nc1cccc(C(=O)NCc2ccccc2F)c1 |
| InChI | InChI=1S/C19H21FN2O2/c1-13-18(9-10-24-13)22-16-7-4-6-14(11-16)19(23)21-12-15-5-2-3-8-17(15)20/h2-8,11,13,18,22H,9-10,12H2,1H3,(H,21,23)/t13-,18-/m0/s1 |
| InChIKey | FCBAHHDGPQJPGC-UGSOOPFHSA-N |
| XLogP | 3.35 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |