C24H24N2O5 — CID 97255770
(3R)-1-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoyl]-3-methyl-3,4-dihydro-2H-1,4-benzodiazepin-5-one (PubChem CID 97255770) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is (3R)-1-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoyl]-3-methyl-3,4-dihydro-2H-1,4-benzodiazepin-5-one.
| Compound Name | (3R)-1-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoyl]-3-methyl-3,4-dihydro-2H-1,4-benzodiazepin-5-one |
|---|---|
| PubChem CID | 97255770 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | (3R)-1-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoyl]-3-methyl-3,4-dihydro-2H-1,4-benzodiazepin-5-one |
| SMILES | COc1ccc2c(C)c(CCC(=O)N3C[C@@H](C)NC(=O)c4ccccc43)c(=O)oc2c1 |
| InChI | InChI=1S/C24H24N2O5/c1-14-13-26(20-7-5-4-6-19(20)23(28)25-14)22(27)11-10-18-15(2)17-9-8-16(30-3)12-21(17)31-24(18)29/h4-9,12,14H,10-11,13H2,1-3H3,(H,25,28)/t14-/m1/s1 |
| InChIKey | IUCUOBUKGJFXOF-CQSZACIVSA-N |
| XLogP | 3.21 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|