About 1-[[5-[(2S,5R)-2-ethyl-5-methylpyrrolidine-1-carbonyl]furan-2-yl]methyl]pyridin-2-one
1-[[5-[(2S,5R)-2-ethyl-5-methylpyrrolidine-1-carbonyl]furan-2-yl]methyl]pyridin-2-one (PubChem CID 97256064) has the molecular formula C18H22N2O3
and a molecular weight of 314.38 g/mol. Its IUPAC name is 1-[[5-[(2S,5R)-2-ethyl-5-methylpyrrolidine-1-carbonyl]furan-2-yl]methyl]pyridin-2-one.
Molecular Properties
| Compound Name | 1-[[5-[(2S,5R)-2-ethyl-5-methylpyrrolidine-1-carbonyl]furan-2-yl]methyl]pyridin-2-one |
| PubChem CID | 97256064 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 1-[[5-[(2S,5R)-2-ethyl-5-methylpyrrolidine-1-carbonyl]furan-2-yl]methyl]pyridin-2-one |
| SMILES | CC[C@H]1CC[C@@H](C)N1C(=O)c1ccc(Cn2ccccc2=O)o1 |
| InChI | InChI=1S/C18H22N2O3/c1-3-14-8-7-13(2)20(14)18(22)16-10-9-15(23-16)12-19-11-5-4-6-17(19)21/h4-6,9-11,13-14H,3,7-8,12H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | QVRABDNBGBIEPU-KGLIPLIRSA-N |
| XLogP | 2.89 |
| TPSA | 55.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[5-[(2S,5R)-2-ethyl-5-methylpyrrolidine-1-carbonyl]furan-2-yl]methyl]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[5-[(2S,5R)-2-ethyl-5-methylpyrrolidine-1-carbonyl]furan-2-yl]methyl]pyridin-2-one?
The IUPAC name of 1-[[5-[(2S,5R)-2-ethyl-5-methylpyrrolidine-1-carbonyl]furan-2-yl]methyl]pyridin-2-one (CID 97256064) is 1-[[5-[(2S,5R)-2-ethyl-5-methylpyrrolidine-1-carbonyl]furan-2-yl]methyl]pyridin-2-one.
What is the SMILES notation for 1-[[5-[(2S,5R)-2-ethyl-5-methylpyrrolidine-1-carbonyl]furan-2-yl]methyl]pyridin-2-one?
The canonical SMILES for 1-[[5-[(2S,5R)-2-ethyl-5-methylpyrrolidine-1-carbonyl]furan-2-yl]methyl]pyridin-2-one is CC[C@H]1CC[C@@H](C)N1C(=O)c1ccc(Cn2ccccc2=O)o1.
What is the InChIKey of 1-[[5-[(2S,5R)-2-ethyl-5-methylpyrrolidine-1-carbonyl]furan-2-yl]methyl]pyridin-2-one?
The InChIKey is QVRABDNBGBIEPU-KGLIPLIRSA-N. The full InChI is InChI=1S/C18H22N2O3/c1-3-14-8-7-13(2)20(14)18(22)16-10-9-15(23-16)12-19-11-5-4-6-17(19)21/h4-6,9-11,13-14H,3,7-8,12H2,1-2H3/t13-,14+/m1/s1.
What are the key properties of 1-[[5-[(2S,5R)-2-ethyl-5-methylpyrrolidine-1-carbonyl]furan-2-yl]methyl]pyridin-2-one?
1-[[5-[(2S,5R)-2-ethyl-5-methylpyrrolidine-1-carbonyl]furan-2-yl]methyl]pyridin-2-one has a molecular weight of 314.38 g/mol, XLogP of 2.89, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[5-[(2S,5R)-2-ethyl-5-methylpyrrolidine-1-carbonyl]furan-2-yl]methyl]pyridin-2-one is sourced from PubChem (CID 97256064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).