C19H18FNO3 — CID 97256231
N-[(1R)-7-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3-dihydro-1,4-benzodioxine-5-carboxamide (PubChem CID 97256231) has the molecular formula C19H18FNO3 and a molecular weight of 327.36 g/mol. Its IUPAC name is N-[(1R)-7-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3-dihydro-1,4-benzodioxine-5-carboxamide.
| Compound Name | N-[(1R)-7-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
|---|---|
| PubChem CID | 97256231 |
| Molecular Formula | C19H18FNO3 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N-[(1R)-7-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
| SMILES | O=C(N[C@@H]1CCCc2ccc(F)cc21)c1cccc2c1OCCO2 |
| InChI | InChI=1S/C19H18FNO3/c20-13-8-7-12-3-1-5-16(15(12)11-13)21-19(22)14-4-2-6-17-18(14)24-10-9-23-17/h2,4,6-8,11,16H,1,3,5,9-10H2,(H,21,22)/t16-/m1/s1 |
| InChIKey | CDRPLGCBVQQIKR-MRXNPFEDSA-N |
| XLogP | 3.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |