About 3-chloro-N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-4-fluorobenzenesulfonamide
3-chloro-N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-4-fluorobenzenesulfonamide (PubChem CID 97256547) has the molecular formula C14H17ClFNO4S
and a molecular weight of 349.81 g/mol. Its IUPAC name is 3-chloro-N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-4-fluorobenzenesulfonamide.
Molecular Properties
| Compound Name | 3-chloro-N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-4-fluorobenzenesulfonamide |
| PubChem CID | 97256547 |
| Molecular Formula | C14H17ClFNO4S |
| Molecular Weight | 349.81 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 3-chloro-N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NC[C@H]1COC2(CCCC2)O1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H17ClFNO4S/c15-12-7-11(3-4-13(12)16)22(18,19)17-8-10-9-20-14(21-10)5-1-2-6-14/h3-4,7,10,17H,1-2,5-6,8-9H2/t10-/m0/s1 |
| InChIKey | NHEXKBMWTHYJPT-JTQLQIEISA-N |
| XLogP | 2.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.81 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-4-fluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-4-fluorobenzenesulfonamide?
The IUPAC name of 3-chloro-N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-4-fluorobenzenesulfonamide (CID 97256547) is 3-chloro-N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-4-fluorobenzenesulfonamide.
What is the SMILES notation for 3-chloro-N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-4-fluorobenzenesulfonamide?
The canonical SMILES for 3-chloro-N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-4-fluorobenzenesulfonamide is O=S(=O)(NC[C@H]1COC2(CCCC2)O1)c1ccc(F)c(Cl)c1.
What is the InChIKey of 3-chloro-N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-4-fluorobenzenesulfonamide?
The InChIKey is NHEXKBMWTHYJPT-JTQLQIEISA-N. The full InChI is InChI=1S/C14H17ClFNO4S/c15-12-7-11(3-4-13(12)16)22(18,19)17-8-10-9-20-14(21-10)5-1-2-6-14/h3-4,7,10,17H,1-2,5-6,8-9H2/t10-/m0/s1.
What are the key properties of 3-chloro-N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-4-fluorobenzenesulfonamide?
3-chloro-N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-4-fluorobenzenesulfonamide has a molecular weight of 349.81 g/mol, XLogP of 2.44, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-4-fluorobenzenesulfonamide is sourced from PubChem (CID 97256547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).