C13H16N2O3 — CID 97256626
methyl (2R,3S)-3-methyl-2-(pyridine-4-carbonylamino)pent-4-enoate (PubChem CID 97256626) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is methyl (2R,3S)-3-methyl-2-(pyridine-4-carbonylamino)pent-4-enoate.
| Compound Name | methyl (2R,3S)-3-methyl-2-(pyridine-4-carbonylamino)pent-4-enoate |
|---|---|
| PubChem CID | 97256626 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | methyl (2R,3S)-3-methyl-2-(pyridine-4-carbonylamino)pent-4-enoate |
| SMILES | C=C[C@H](C)[C@@H](NC(=O)c1ccncc1)C(=O)OC |
| InChI | InChI=1S/C13H16N2O3/c1-4-9(2)11(13(17)18-3)15-12(16)10-5-7-14-8-6-10/h4-9,11H,1H2,2-3H3,(H,15,16)/t9-,11+/m0/s1 |
| InChIKey | PDBVWAHNYKZXCI-GXSJLCMTSA-N |
| XLogP | 1.18 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|