About 1-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-3-[2-(trifluoromethylsulfanyl)phenyl]urea
1-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-3-[2-(trifluoromethylsulfanyl)phenyl]urea (PubChem CID 97256676) has the molecular formula C16H19F3N2O3S
and a molecular weight of 376.40 g/mol. Its IUPAC name is 1-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-3-[2-(trifluoromethylsulfanyl)phenyl]urea.
Molecular Properties
| Compound Name | 1-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-3-[2-(trifluoromethylsulfanyl)phenyl]urea |
| PubChem CID | 97256676 |
| Molecular Formula | C16H19F3N2O3S |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 1-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-3-[2-(trifluoromethylsulfanyl)phenyl]urea |
| SMILES | O=C(NC[C@H]1COC2(CCCC2)O1)Nc1ccccc1SC(F)(F)F |
| InChI | InChI=1S/C16H19F3N2O3S/c17-16(18,19)25-13-6-2-1-5-12(13)21-14(22)20-9-11-10-23-15(24-11)7-3-4-8-15/h1-2,5-6,11H,3-4,7-10H2,(H2,20,21,22)/t11-/m0/s1 |
| InChIKey | WNTWOEMJGOWKNE-NSHDSACASA-N |
| XLogP | 4.11 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-3-[2-(trifluoromethylsulfanyl)phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-3-[2-(trifluoromethylsulfanyl)phenyl]urea?
The IUPAC name of 1-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-3-[2-(trifluoromethylsulfanyl)phenyl]urea (CID 97256676) is 1-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-3-[2-(trifluoromethylsulfanyl)phenyl]urea.
What is the SMILES notation for 1-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-3-[2-(trifluoromethylsulfanyl)phenyl]urea?
The canonical SMILES for 1-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-3-[2-(trifluoromethylsulfanyl)phenyl]urea is O=C(NC[C@H]1COC2(CCCC2)O1)Nc1ccccc1SC(F)(F)F.
What is the InChIKey of 1-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-3-[2-(trifluoromethylsulfanyl)phenyl]urea?
The InChIKey is WNTWOEMJGOWKNE-NSHDSACASA-N. The full InChI is InChI=1S/C16H19F3N2O3S/c17-16(18,19)25-13-6-2-1-5-12(13)21-14(22)20-9-11-10-23-15(24-11)7-3-4-8-15/h1-2,5-6,11H,3-4,7-10H2,(H2,20,21,22)/t11-/m0/s1.
What are the key properties of 1-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-3-[2-(trifluoromethylsulfanyl)phenyl]urea?
1-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-3-[2-(trifluoromethylsulfanyl)phenyl]urea has a molecular weight of 376.40 g/mol, XLogP of 4.11, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-3-[2-(trifluoromethylsulfanyl)phenyl]urea is sourced from PubChem (CID 97256676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).