C18H26N2O3S — CID 97256936
(2R,5R)-N,N-dimethyl-5-[[[(6R)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]methyl]oxolane-2-carboxamide (PubChem CID 97256936) has the molecular formula C18H26N2O3S and a molecular weight of 350.48 g/mol. Its IUPAC name is (2R,5R)-N,N-dimethyl-5-[[[(6R)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]methyl]oxolane-2-carboxamide.
| Compound Name | (2R,5R)-N,N-dimethyl-5-[[[(6R)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]methyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 97256936 |
| Molecular Formula | C18H26N2O3S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (2R,5R)-N,N-dimethyl-5-[[[(6R)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]methyl]oxolane-2-carboxamide |
| SMILES | C[C@@H]1CCc2c(C(=O)NC[C@H]3CC[C@H](C(=O)N(C)C)O3)csc2C1 |
| InChI | InChI=1S/C18H26N2O3S/c1-11-4-6-13-14(10-24-16(13)8-11)17(21)19-9-12-5-7-15(23-12)18(22)20(2)3/h10-12,15H,4-9H2,1-3H3,(H,19,21)/t11-,12-,15-/m1/s1 |
| InChIKey | GPDNSQJTUZPCBB-LALPHHSUSA-N |
| XLogP | 2.24 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |