C14H25N3OS2 — CID 97257095
2-[4-[[(4aR,5R,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]dithiin-5-yl]amino]piperidin-1-yl]acetamide (PubChem CID 97257095) has the molecular formula C14H25N3OS2 and a molecular weight of 315.51 g/mol. Its IUPAC name is 2-[4-[[(4aR,5R,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]dithiin-5-yl]amino]piperidin-1-yl]acetamide.
| Compound Name | 2-[4-[[(4aR,5R,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]dithiin-5-yl]amino]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 97257095 |
| Molecular Formula | C14H25N3OS2 |
| Molecular Weight | 315.51 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2-[4-[[(4aR,5R,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]dithiin-5-yl]amino]piperidin-1-yl]acetamide |
| SMILES | NC(=O)CN1CCC(N[C@@H]2CC[C@H]3SCCS[C@H]23)CC1 |
| InChI | InChI=1S/C14H25N3OS2/c15-13(18)9-17-5-3-10(4-6-17)16-11-1-2-12-14(11)20-8-7-19-12/h10-12,14,16H,1-9H2,(H2,15,18)/t11-,12-,14-/m1/s1 |
| InChIKey | NPPYAUDXRWWYCI-YRGRVCCFSA-N |
| XLogP | 0.91 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.51 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |