C16H19N5O2S — CID 97257586
N'-[(1S)-1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)ethyl]-N-(3-methylsulfanylphenyl)oxamide (PubChem CID 97257586) has the molecular formula C16H19N5O2S and a molecular weight of 345.43 g/mol. Its IUPAC name is N'-[(1S)-1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)ethyl]-N-(3-methylsulfanylphenyl)oxamide.
| Compound Name | N'-[(1S)-1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)ethyl]-N-(3-methylsulfanylphenyl)oxamide |
|---|---|
| PubChem CID | 97257586 |
| Molecular Formula | C16H19N5O2S |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | N'-[(1S)-1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)ethyl]-N-(3-methylsulfanylphenyl)oxamide |
| SMILES | CSc1cccc(NC(=O)C(=O)N[C@@H](C)c2nnc3n2CCC3)c1 |
| InChI | InChI=1S/C16H19N5O2S/c1-10(14-20-19-13-7-4-8-21(13)14)17-15(22)16(23)18-11-5-3-6-12(9-11)24-2/h3,5-6,9-10H,4,7-8H2,1-2H3,(H,17,22)(H,18,23)/t10-/m0/s1 |
| InChIKey | APECCRVPVGSARE-JTQLQIEISA-N |
| XLogP | 1.76 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|