About N-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide
N-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide (PubChem CID 97258189) has the molecular formula C10H12F3NO3S
and a molecular weight of 283.27 g/mol. Its IUPAC name is N-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide |
| PubChem CID | 97258189 |
| Molecular Formula | C10H12F3NO3S |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | N-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide |
| SMILES | CN(C[C@H](O)C(F)(F)F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C10H12F3NO3S/c1-14(7-9(15)10(11,12)13)18(16,17)8-5-3-2-4-6-8/h2-6,9,15H,7H2,1H3/t9-/m0/s1 |
| InChIKey | QAGYDZYFWXZYPV-VIFPVBQESA-N |
| XLogP | 1.23 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide?
The IUPAC name of N-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide (CID 97258189) is N-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide.
What is the SMILES notation for N-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide?
The canonical SMILES for N-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide is CN(C[C@H](O)C(F)(F)F)S(=O)(=O)c1ccccc1.
What is the InChIKey of N-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide?
The InChIKey is QAGYDZYFWXZYPV-VIFPVBQESA-N. The full InChI is InChI=1S/C10H12F3NO3S/c1-14(7-9(15)10(11,12)13)18(16,17)8-5-3-2-4-6-8/h2-6,9,15H,7H2,1H3/t9-/m0/s1.
What are the key properties of N-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide?
N-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide has a molecular weight of 283.27 g/mol, XLogP of 1.23, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]benzenesulfonamide is sourced from PubChem (CID 97258189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).