C18H19F3N2OS — CID 97258354
2,5-dimethyl-N-[(8R)-5,6,7,8-tetrahydroquinolin-8-yl]-N-(2,2,2-trifluoroethyl)thiophene-3-carboxamide (PubChem CID 97258354) has the molecular formula C18H19F3N2OS and a molecular weight of 368.42 g/mol. Its IUPAC name is 2,5-dimethyl-N-[(8R)-5,6,7,8-tetrahydroquinolin-8-yl]-N-(2,2,2-trifluoroethyl)thiophene-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-[(8R)-5,6,7,8-tetrahydroquinolin-8-yl]-N-(2,2,2-trifluoroethyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 97258354 |
| Molecular Formula | C18H19F3N2OS |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2,5-dimethyl-N-[(8R)-5,6,7,8-tetrahydroquinolin-8-yl]-N-(2,2,2-trifluoroethyl)thiophene-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(CC(F)(F)F)[C@@H]2CCCc3cccnc32)c(C)s1 |
| InChI | InChI=1S/C18H19F3N2OS/c1-11-9-14(12(2)25-11)17(24)23(10-18(19,20)21)15-7-3-5-13-6-4-8-22-16(13)15/h4,6,8-9,15H,3,5,7,10H2,1-2H3/t15-/m1/s1 |
| InChIKey | XZPYRTPGXVHBRZ-OAHLLOKOSA-N |
| XLogP | 4.84 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |