About 3-[[(1S)-1-cyclohexyl-2-methylpropyl]amino]-N,N-diethylpropanamide
3-[[(1S)-1-cyclohexyl-2-methylpropyl]amino]-N,N-diethylpropanamide (PubChem CID 97258642) has the molecular formula C17H34N2O
and a molecular weight of 282.47 g/mol. Its IUPAC name is 3-[[(1S)-1-cyclohexyl-2-methylpropyl]amino]-N,N-diethylpropanamide.
Molecular Properties
| Compound Name | 3-[[(1S)-1-cyclohexyl-2-methylpropyl]amino]-N,N-diethylpropanamide |
| PubChem CID | 97258642 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | 3-[[(1S)-1-cyclohexyl-2-methylpropyl]amino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCN[C@@H](C(C)C)C1CCCCC1 |
| InChI | InChI=1S/C17H34N2O/c1-5-19(6-2)16(20)12-13-18-17(14(3)4)15-10-8-7-9-11-15/h14-15,17-18H,5-13H2,1-4H3/t17-/m0/s1 |
| InChIKey | ZNWOFBNJDCKPOX-KRWDZBQOSA-N |
| XLogP | 3.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[(1S)-1-cyclohexyl-2-methylpropyl]amino]-N,N-diethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(1S)-1-cyclohexyl-2-methylpropyl]amino]-N,N-diethylpropanamide?
The IUPAC name of 3-[[(1S)-1-cyclohexyl-2-methylpropyl]amino]-N,N-diethylpropanamide (CID 97258642) is 3-[[(1S)-1-cyclohexyl-2-methylpropyl]amino]-N,N-diethylpropanamide.
What is the SMILES notation for 3-[[(1S)-1-cyclohexyl-2-methylpropyl]amino]-N,N-diethylpropanamide?
The canonical SMILES for 3-[[(1S)-1-cyclohexyl-2-methylpropyl]amino]-N,N-diethylpropanamide is CCN(CC)C(=O)CCN[C@@H](C(C)C)C1CCCCC1.
What is the InChIKey of 3-[[(1S)-1-cyclohexyl-2-methylpropyl]amino]-N,N-diethylpropanamide?
The InChIKey is ZNWOFBNJDCKPOX-KRWDZBQOSA-N. The full InChI is InChI=1S/C17H34N2O/c1-5-19(6-2)16(20)12-13-18-17(14(3)4)15-10-8-7-9-11-15/h14-15,17-18H,5-13H2,1-4H3/t17-/m0/s1.
What are the key properties of 3-[[(1S)-1-cyclohexyl-2-methylpropyl]amino]-N,N-diethylpropanamide?
3-[[(1S)-1-cyclohexyl-2-methylpropyl]amino]-N,N-diethylpropanamide has a molecular weight of 282.47 g/mol, XLogP of 3.44, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(1S)-1-cyclohexyl-2-methylpropyl]amino]-N,N-diethylpropanamide is sourced from PubChem (CID 97258642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).