C21H27FN4O3 — CID 97260116
(2S)-N-[(4-cyano-2-fluorophenyl)methyl]-2-(3-cyclopentylpropanoylamino)pentanediamide (PubChem CID 97260116) has the molecular formula C21H27FN4O3 and a molecular weight of 402.47 g/mol. Its IUPAC name is (2S)-N-[(4-cyano-2-fluorophenyl)methyl]-2-(3-cyclopentylpropanoylamino)pentanediamide.
| Compound Name | (2S)-N-[(4-cyano-2-fluorophenyl)methyl]-2-(3-cyclopentylpropanoylamino)pentanediamide |
|---|---|
| PubChem CID | 97260116 |
| Molecular Formula | C21H27FN4O3 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (2S)-N-[(4-cyano-2-fluorophenyl)methyl]-2-(3-cyclopentylpropanoylamino)pentanediamide |
| SMILES | N#Cc1ccc(CNC(=O)[C@H](CCC(N)=O)NC(=O)CCC2CCCC2)c(F)c1 |
| InChI | InChI=1S/C21H27FN4O3/c22-17-11-15(12-23)5-7-16(17)13-25-21(29)18(8-9-19(24)27)26-20(28)10-6-14-3-1-2-4-14/h5,7,11,14,18H,1-4,6,8-10,13H2,(H2,24,27)(H,25,29)(H,26,28)/t18-/m0/s1 |
| InChIKey | KJMRHHGHCXHVKE-SFHVURJKSA-N |
| XLogP | 2.03 |
| TPSA | 125.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |