C23H28N2O4 — CID 97260298
N-[3-[(3S)-3-hydroxypiperidine-1-carbonyl]phenyl]-4-(4-methoxyphenyl)butanamide (PubChem CID 97260298) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[3-[(3S)-3-hydroxypiperidine-1-carbonyl]phenyl]-4-(4-methoxyphenyl)butanamide.
| Compound Name | N-[3-[(3S)-3-hydroxypiperidine-1-carbonyl]phenyl]-4-(4-methoxyphenyl)butanamide |
|---|---|
| PubChem CID | 97260298 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-[3-[(3S)-3-hydroxypiperidine-1-carbonyl]phenyl]-4-(4-methoxyphenyl)butanamide |
| SMILES | COc1ccc(CCCC(=O)Nc2cccc(C(=O)N3CCC[C@H](O)C3)c2)cc1 |
| InChI | InChI=1S/C23H28N2O4/c1-29-21-12-10-17(11-13-21)5-2-9-22(27)24-19-7-3-6-18(15-19)23(28)25-14-4-8-20(26)16-25/h3,6-7,10-13,15,20,26H,2,4-5,8-9,14,16H2,1H3,(H,24,27)/t20-/m0/s1 |
| InChIKey | FJZHGZPHJUGWGO-FQEVSTJZSA-N |
| XLogP | 3.25 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |