About methyl (2R)-2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methylamino]-2-methylpentanoate
methyl (2R)-2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methylamino]-2-methylpentanoate (PubChem CID 97261623) has the molecular formula C18H27NO3
and a molecular weight of 305.42 g/mol. Its IUPAC name is methyl (2R)-2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methylamino]-2-methylpentanoate.
Molecular Properties
| Compound Name | methyl (2R)-2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methylamino]-2-methylpentanoate |
| PubChem CID | 97261623 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | methyl (2R)-2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methylamino]-2-methylpentanoate |
| SMILES | CCC[C@@](C)(NCc1cccc2c1OC(C)(C)C2)C(=O)OC |
| InChI | InChI=1S/C18H27NO3/c1-6-10-18(4,16(20)21-5)19-12-14-9-7-8-13-11-17(2,3)22-15(13)14/h7-9,19H,6,10-12H2,1-5H3/t18-/m1/s1 |
| InChIKey | ICGMNILIYIGSHT-GOSISDBHSA-N |
| XLogP | 3.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2R)-2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methylamino]-2-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methylamino]-2-methylpentanoate?
The IUPAC name of methyl (2R)-2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methylamino]-2-methylpentanoate (CID 97261623) is methyl (2R)-2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methylamino]-2-methylpentanoate.
What is the SMILES notation for methyl (2R)-2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methylamino]-2-methylpentanoate?
The canonical SMILES for methyl (2R)-2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methylamino]-2-methylpentanoate is CCC[C@@](C)(NCc1cccc2c1OC(C)(C)C2)C(=O)OC.
What is the InChIKey of methyl (2R)-2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methylamino]-2-methylpentanoate?
The InChIKey is ICGMNILIYIGSHT-GOSISDBHSA-N. The full InChI is InChI=1S/C18H27NO3/c1-6-10-18(4,16(20)21-5)19-12-14-9-7-8-13-11-17(2,3)22-15(13)14/h7-9,19H,6,10-12H2,1-5H3/t18-/m1/s1.
What are the key properties of methyl (2R)-2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methylamino]-2-methylpentanoate?
methyl (2R)-2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methylamino]-2-methylpentanoate has a molecular weight of 305.42 g/mol, XLogP of 3.22, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methylamino]-2-methylpentanoate is sourced from PubChem (CID 97261623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).