C17H29N3S — CID 97262100
5-[[(3R,8aR)-3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-2-(2-methylpropyl)-1,3-thiazole (PubChem CID 97262100) has the molecular formula C17H29N3S and a molecular weight of 307.51 g/mol. Its IUPAC name is 5-[[(3R,8aR)-3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-2-(2-methylpropyl)-1,3-thiazole.
| Compound Name | 5-[[(3R,8aR)-3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-2-(2-methylpropyl)-1,3-thiazole |
|---|---|
| PubChem CID | 97262100 |
| Molecular Formula | C17H29N3S |
| Molecular Weight | 307.51 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 5-[[(3R,8aR)-3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-2-(2-methylpropyl)-1,3-thiazole |
| SMILES | CC[C@@H]1CN2CCC[C@@H]2CN1Cc1cnc(CC(C)C)s1 |
| InChI | InChI=1S/C17H29N3S/c1-4-14-10-19-7-5-6-15(19)11-20(14)12-16-9-18-17(21-16)8-13(2)3/h9,13-15H,4-8,10-12H2,1-3H3/t14-,15-/m1/s1 |
| InChIKey | QGSLXSGUZBEJMH-HUUCEWRRSA-N |
| XLogP | 3.40 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |