About N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-2,2-diethylbutan-1-amine
N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-2,2-diethylbutan-1-amine (PubChem CID 97262516) has the molecular formula C13H27NO2S
and a molecular weight of 261.43 g/mol. Its IUPAC name is N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-2,2-diethylbutan-1-amine.
Molecular Properties
| Compound Name | N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-2,2-diethylbutan-1-amine |
| PubChem CID | 97262516 |
| Molecular Formula | C13H27NO2S |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-2,2-diethylbutan-1-amine |
| SMILES | CCC(CC)(CC)CNC[C@H]1CCCS1(=O)=O |
| InChI | InChI=1S/C13H27NO2S/c1-4-13(5-2,6-3)11-14-10-12-8-7-9-17(12,15)16/h12,14H,4-11H2,1-3H3/t12-/m1/s1 |
| InChIKey | SHOFNDRLPIYNIM-GFCCVEGCSA-N |
| XLogP | 2.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-2,2-diethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-2,2-diethylbutan-1-amine?
The IUPAC name of N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-2,2-diethylbutan-1-amine (CID 97262516) is N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-2,2-diethylbutan-1-amine.
What is the SMILES notation for N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-2,2-diethylbutan-1-amine?
The canonical SMILES for N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-2,2-diethylbutan-1-amine is CCC(CC)(CC)CNC[C@H]1CCCS1(=O)=O.
What is the InChIKey of N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-2,2-diethylbutan-1-amine?
The InChIKey is SHOFNDRLPIYNIM-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H27NO2S/c1-4-13(5-2,6-3)11-14-10-12-8-7-9-17(12,15)16/h12,14H,4-11H2,1-3H3/t12-/m1/s1.
What are the key properties of N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-2,2-diethylbutan-1-amine?
N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-2,2-diethylbutan-1-amine has a molecular weight of 261.43 g/mol, XLogP of 2.37, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-2,2-diethylbutan-1-amine is sourced from PubChem (CID 97262516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).