C17H17F2N3O2S — CID 97263603
(4R)-1-cyclopentyl-4-(2,4-difluorophenyl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione (PubChem CID 97263603) has the molecular formula C17H17F2N3O2S and a molecular weight of 365.41 g/mol. Its IUPAC name is (4R)-1-cyclopentyl-4-(2,4-difluorophenyl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione.
| Compound Name | (4R)-1-cyclopentyl-4-(2,4-difluorophenyl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione |
|---|---|
| PubChem CID | 97263603 |
| Molecular Formula | C17H17F2N3O2S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | (4R)-1-cyclopentyl-4-(2,4-difluorophenyl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione |
| SMILES | O=C1CS[C@@H](c2ccc(F)cc2F)c2c(n(C3CCCC3)[nH]c2=O)N1 |
| InChI | InChI=1S/C17H17F2N3O2S/c18-9-5-6-11(12(19)7-9)15-14-16(20-13(23)8-25-15)22(21-17(14)24)10-3-1-2-4-10/h5-7,10,15H,1-4,8H2,(H,20,23)(H,21,24)/t15-/m0/s1 |
| InChIKey | LKRNTEVCRCRZCO-HNNXBMFYSA-N |
| XLogP | 3.34 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |