C16H18N4O4 — CID 97265132
(4R)-1-(oxan-4-yl)-4-(2-oxo-1H-pyridin-3-yl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione (PubChem CID 97265132) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is (4R)-1-(oxan-4-yl)-4-(2-oxo-1H-pyridin-3-yl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione.
| Compound Name | (4R)-1-(oxan-4-yl)-4-(2-oxo-1H-pyridin-3-yl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione |
|---|---|
| PubChem CID | 97265132 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (4R)-1-(oxan-4-yl)-4-(2-oxo-1H-pyridin-3-yl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione |
| SMILES | O=C1C[C@H](c2ccc[nH]c2=O)c2c(n(C3CCOCC3)[nH]c2=O)N1 |
| InChI | InChI=1S/C16H18N4O4/c21-12-8-11(10-2-1-5-17-15(10)22)13-14(18-12)20(19-16(13)23)9-3-6-24-7-4-9/h1-2,5,9,11H,3-4,6-8H2,(H,17,22)(H,18,21)(H,19,23)/t11-/m1/s1 |
| InChIKey | JJRHLVZJTPUZRP-LLVKDONJSA-N |
| XLogP | 0.69 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |