C24H36N2O4S — CID 97265341
N-[[4-[(4aR,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carbonyl]cyclohexyl]methyl]-4-methylbenzenesulfonamide (PubChem CID 97265341) has the molecular formula C24H36N2O4S and a molecular weight of 448.63 g/mol. Its IUPAC name is N-[[4-[(4aR,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carbonyl]cyclohexyl]methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[[4-[(4aR,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carbonyl]cyclohexyl]methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 97265341 |
| Molecular Formula | C24H36N2O4S |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | N-[[4-[(4aR,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carbonyl]cyclohexyl]methyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC2CCC(C(=O)N3CC[C@]4(O)CCCC[C@@H]4C3)CC2)cc1 |
| InChI | InChI=1S/C24H36N2O4S/c1-18-5-11-22(12-6-18)31(29,30)25-16-19-7-9-20(10-8-19)23(27)26-15-14-24(28)13-3-2-4-21(24)17-26/h5-6,11-12,19-21,25,28H,2-4,7-10,13-17H2,1H3/t19?,20?,21-,24-/m1/s1 |
| InChIKey | GNGOGENXRXJQPQ-XLYGXDRMSA-N |
| XLogP | 3.23 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |