C21H23N3O3 — CID 97266007
N-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-[3-(2-methoxyphenyl)-6-oxopyridazin-1-yl]acetamide (PubChem CID 97266007) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is N-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-[3-(2-methoxyphenyl)-6-oxopyridazin-1-yl]acetamide.
| Compound Name | N-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-[3-(2-methoxyphenyl)-6-oxopyridazin-1-yl]acetamide |
|---|---|
| PubChem CID | 97266007 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-[3-(2-methoxyphenyl)-6-oxopyridazin-1-yl]acetamide |
| SMILES | COc1ccccc1-c1ccc(=O)n(CC(=O)NC[C@@H]2C[C@@H]3C=C[C@H]2C3)n1 |
| InChI | InChI=1S/C21H23N3O3/c1-27-19-5-3-2-4-17(19)18-8-9-21(26)24(23-18)13-20(25)22-12-16-11-14-6-7-15(16)10-14/h2-9,14-16H,10-13H2,1H3,(H,22,25)/t14-,15+,16+/m1/s1 |
| InChIKey | LRWTYMVGOKIRTD-PMPSAXMXSA-N |
| XLogP | 2.25 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|