C20H23ClN2O2S — CID 97266052
[(4aR,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-[2-(2-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]methanone (PubChem CID 97266052) has the molecular formula C20H23ClN2O2S and a molecular weight of 390.94 g/mol. Its IUPAC name is [(4aR,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-[2-(2-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]methanone.
| Compound Name | [(4aR,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-[2-(2-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 97266052 |
| Molecular Formula | C20H23ClN2O2S |
| Molecular Weight | 390.94 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | [(4aR,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-[2-(2-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]methanone |
| SMILES | Cc1nc(-c2ccccc2Cl)sc1C(=O)N1CC[C@]2(O)CCCC[C@@H]2C1 |
| InChI | InChI=1S/C20H23ClN2O2S/c1-13-17(26-18(22-13)15-7-2-3-8-16(15)21)19(24)23-11-10-20(25)9-5-4-6-14(20)12-23/h2-3,7-8,14,25H,4-6,9-12H2,1H3/t14-,20-/m1/s1 |
| InChIKey | XYHKPMDZZHOZHP-JLTOFOAXSA-N |
| XLogP | 4.54 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.94 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |