C23H19F3N2O3 — CID 97266165
(3S)-N-(furan-2-ylmethyl)-3-(4-methoxy-1H-indol-3-yl)-3-(2,3,4-trifluorophenyl)propanamide (PubChem CID 97266165) has the molecular formula C23H19F3N2O3 and a molecular weight of 428.41 g/mol. Its IUPAC name is (3S)-N-(furan-2-ylmethyl)-3-(4-methoxy-1H-indol-3-yl)-3-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (3S)-N-(furan-2-ylmethyl)-3-(4-methoxy-1H-indol-3-yl)-3-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 97266165 |
| Molecular Formula | C23H19F3N2O3 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | (3S)-N-(furan-2-ylmethyl)-3-(4-methoxy-1H-indol-3-yl)-3-(2,3,4-trifluorophenyl)propanamide |
| SMILES | COc1cccc2[nH]cc([C@H](CC(=O)NCc3ccco3)c3ccc(F)c(F)c3F)c12 |
| InChI | InChI=1S/C23H19F3N2O3/c1-30-19-6-2-5-18-21(19)16(12-27-18)15(14-7-8-17(24)23(26)22(14)25)10-20(29)28-11-13-4-3-9-31-13/h2-9,12,15,27H,10-11H2,1H3,(H,28,29)/t15-/m1/s1 |
| InChIKey | YLLQWECEAVUPPH-OAHLLOKOSA-N |
| XLogP | 5.03 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|