C17H22BrN3O — CID 97266614
2-(6-bromoindol-1-yl)-N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]acetamide (PubChem CID 97266614) has the molecular formula C17H22BrN3O and a molecular weight of 364.29 g/mol. Its IUPAC name is 2-(6-bromoindol-1-yl)-N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]acetamide.
| Compound Name | 2-(6-bromoindol-1-yl)-N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 97266614 |
| Molecular Formula | C17H22BrN3O |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-(6-bromoindol-1-yl)-N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]acetamide |
| SMILES | CCN1CCC[C@@H]1CNC(=O)Cn1ccc2ccc(Br)cc21 |
| InChI | InChI=1S/C17H22BrN3O/c1-2-20-8-3-4-15(20)11-19-17(22)12-21-9-7-13-5-6-14(18)10-16(13)21/h5-7,9-10,15H,2-4,8,11-12H2,1H3,(H,19,22)/t15-/m1/s1 |
| InChIKey | PIIOQUGCEVRXIS-OAHLLOKOSA-N |
| XLogP | 3.00 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |