C14H16N4O3 — CID 97266662
(3R)-N-(2-hydroxyethyl)-1-(1H-indazol-3-yl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 97266662) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is (3R)-N-(2-hydroxyethyl)-1-(1H-indazol-3-yl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-(2-hydroxyethyl)-1-(1H-indazol-3-yl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 97266662 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | (3R)-N-(2-hydroxyethyl)-1-(1H-indazol-3-yl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCCO)[C@@H]1CC(=O)N(c2n[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C14H16N4O3/c19-6-5-15-14(21)9-7-12(20)18(8-9)13-10-3-1-2-4-11(10)16-17-13/h1-4,9,19H,5-8H2,(H,15,21)(H,16,17)/t9-/m1/s1 |
| InChIKey | BMSJFLQGUZAEGR-SECBINFHSA-N |
| XLogP | 0.02 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |