C22H30N4O3S — CID 97267616
(2S)-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-2-(N-methylsulfonylanilino)propanamide (PubChem CID 97267616) has the molecular formula C22H30N4O3S and a molecular weight of 430.57 g/mol. Its IUPAC name is (2S)-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-2-(N-methylsulfonylanilino)propanamide.
| Compound Name | (2S)-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-2-(N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 97267616 |
| Molecular Formula | C22H30N4O3S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | (2S)-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-2-(N-methylsulfonylanilino)propanamide |
| SMILES | C[C@@H](C(=O)NCc1ccc(N2CCN(C)CC2)cc1)N(c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C22H30N4O3S/c1-18(26(30(3,28)29)21-7-5-4-6-8-21)22(27)23-17-19-9-11-20(12-10-19)25-15-13-24(2)14-16-25/h4-12,18H,13-17H2,1-3H3,(H,23,27)/t18-/m0/s1 |
| InChIKey | SPAUHPJCDWZAAW-SFHVURJKSA-N |
| XLogP | 1.91 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|