C12H16N4O3 — CID 97271863
(2R)-1-[2-(dimethylamino)-4-methylpyrimidine-5-carbonyl]azetidine-2-carboxylic acid (PubChem CID 97271863) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is (2R)-1-[2-(dimethylamino)-4-methylpyrimidine-5-carbonyl]azetidine-2-carboxylic acid.
| Compound Name | (2R)-1-[2-(dimethylamino)-4-methylpyrimidine-5-carbonyl]azetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 97271863 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (2R)-1-[2-(dimethylamino)-4-methylpyrimidine-5-carbonyl]azetidine-2-carboxylic acid |
| SMILES | Cc1nc(N(C)C)ncc1C(=O)N1CC[C@@H]1C(=O)O |
| InChI | InChI=1S/C12H16N4O3/c1-7-8(6-13-12(14-7)15(2)3)10(17)16-5-4-9(16)11(18)19/h6,9H,4-5H2,1-3H3,(H,18,19)/t9-/m1/s1 |
| InChIKey | RBAAHIOBAGTYEL-SECBINFHSA-N |
| XLogP | 0.15 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |