C14H19N5S2 — CID 97272009
N-[(1R)-1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-N,1,3-trimethylpyrazolo[5,4-d][1,3]thiazol-5-amine (PubChem CID 97272009) has the molecular formula C14H19N5S2 and a molecular weight of 321.48 g/mol. Its IUPAC name is N-[(1R)-1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-N,1,3-trimethylpyrazolo[5,4-d][1,3]thiazol-5-amine.
| Compound Name | N-[(1R)-1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-N,1,3-trimethylpyrazolo[5,4-d][1,3]thiazol-5-amine |
|---|---|
| PubChem CID | 97272009 |
| Molecular Formula | C14H19N5S2 |
| Molecular Weight | 321.48 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-[(1R)-1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-N,1,3-trimethylpyrazolo[5,4-d][1,3]thiazol-5-amine |
| SMILES | Cc1nc([C@@H](C)N(C)c2nc3c(s2)c(C)nn3C)c(C)s1 |
| InChI | InChI=1S/C14H19N5S2/c1-7-12-13(19(6)17-7)16-14(21-12)18(5)8(2)11-9(3)20-10(4)15-11/h8H,1-6H3/t8-/m1/s1 |
| InChIKey | WMOINEAHZQGQJB-MRVPVSSYSA-N |
| XLogP | 3.61 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |