C14H18FN3O3 — CID 97273530
(3S)-N-(2-fluoro-3-pyridinyl)-3-hydroxy-1-oxa-8-azaspiro[4.5]decane-8-carboxamide (PubChem CID 97273530) has the molecular formula C14H18FN3O3 and a molecular weight of 295.31 g/mol. Its IUPAC name is (3S)-N-(2-fluoro-3-pyridinyl)-3-hydroxy-1-oxa-8-azaspiro[4.5]decane-8-carboxamide.
| Compound Name | (3S)-N-(2-fluoro-3-pyridinyl)-3-hydroxy-1-oxa-8-azaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 97273530 |
| Molecular Formula | C14H18FN3O3 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (3S)-N-(2-fluoro-3-pyridinyl)-3-hydroxy-1-oxa-8-azaspiro[4.5]decane-8-carboxamide |
| SMILES | O=C(Nc1cccnc1F)N1CCC2(CC1)C[C@H](O)CO2 |
| InChI | InChI=1S/C14H18FN3O3/c15-12-11(2-1-5-16-12)17-13(20)18-6-3-14(4-7-18)8-10(19)9-21-14/h1-2,5,10,19H,3-4,6-9H2,(H,17,20)/t10-/m0/s1 |
| InChIKey | RGNWIRHKGXXRLQ-JTQLQIEISA-N |
| XLogP | 1.37 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|