C15H15NO3 — CID 97275381
(3S)-N-(furan-3-ylmethyl)-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 97275381) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is (3S)-N-(furan-3-ylmethyl)-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | (3S)-N-(furan-3-ylmethyl)-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 97275381 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | (3S)-N-(furan-3-ylmethyl)-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | O=C(NCc1ccoc1)[C@@H]1COc2ccccc2C1 |
| InChI | InChI=1S/C15H15NO3/c17-15(16-8-11-5-6-18-9-11)13-7-12-3-1-2-4-14(12)19-10-13/h1-6,9,13H,7-8,10H2,(H,16,17)/t13-/m0/s1 |
| InChIKey | FNCJBBINXXGCQL-ZDUSSCGKSA-N |
| XLogP | 2.15 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |