C19H26N4O — CID 97275898
(3S)-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 97275898) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is (3S)-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3S)-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 97275898 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | (3S)-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | Cc1n[nH]c(C)c1CCCNC(=O)[C@@H]1Cc2ccccc2CN1C |
| InChI | InChI=1S/C19H26N4O/c1-13-17(14(2)22-21-13)9-6-10-20-19(24)18-11-15-7-4-5-8-16(15)12-23(18)3/h4-5,7-8,18H,6,9-12H2,1-3H3,(H,20,24)(H,21,22)/t18-/m0/s1 |
| InChIKey | SZQFKPIRPFOTKF-SFHVURJKSA-N |
| XLogP | 2.13 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|