C20H21ClN2O3 — CID 97276904
(4S)-N-[2-[(2-chlorobenzoyl)amino]ethyl]-2,3,4,5-tetrahydro-1-benzoxepine-4-carboxamide (PubChem CID 97276904) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is (4S)-N-[2-[(2-chlorobenzoyl)amino]ethyl]-2,3,4,5-tetrahydro-1-benzoxepine-4-carboxamide.
| Compound Name | (4S)-N-[2-[(2-chlorobenzoyl)amino]ethyl]-2,3,4,5-tetrahydro-1-benzoxepine-4-carboxamide |
|---|---|
| PubChem CID | 97276904 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | (4S)-N-[2-[(2-chlorobenzoyl)amino]ethyl]-2,3,4,5-tetrahydro-1-benzoxepine-4-carboxamide |
| SMILES | O=C(NCCNC(=O)[C@@H]1CCOc2ccccc2C1)c1ccccc1Cl |
| InChI | InChI=1S/C20H21ClN2O3/c21-17-7-3-2-6-16(17)20(25)23-11-10-22-19(24)15-9-12-26-18-8-4-1-5-14(18)13-15/h1-8,15H,9-13H2,(H,22,24)(H,23,25)/t15-/m1/s1 |
| InChIKey | MZGZXAXRKGJMRH-OAHLLOKOSA-N |
| XLogP | 2.83 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|