C21H30N4O2 — CID 97278533
(2R)-N-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-1-(2-ethoxyethyl)piperidine-2-carboxamide (PubChem CID 97278533) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is (2R)-N-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-1-(2-ethoxyethyl)piperidine-2-carboxamide.
| Compound Name | (2R)-N-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-1-(2-ethoxyethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 97278533 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | (2R)-N-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-1-(2-ethoxyethyl)piperidine-2-carboxamide |
| SMILES | CCOCCN1CCCC[C@@H]1C(=O)Nc1ccc(-n2nc(C)cc2C)cc1 |
| InChI | InChI=1S/C21H30N4O2/c1-4-27-14-13-24-12-6-5-7-20(24)21(26)22-18-8-10-19(11-9-18)25-17(3)15-16(2)23-25/h8-11,15,20H,4-7,12-14H2,1-3H3,(H,22,26)/t20-/m1/s1 |
| InChIKey | UWAZEJUGIPXPLS-HXUWFJFHSA-N |
| XLogP | 3.32 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|