About N-[(3-ethyl-1,2-oxazol-5-yl)methyl]-N-methyl-2-[(2S)-2-methyl-5-oxopyrrolidin-1-yl]acetamide
N-[(3-ethyl-1,2-oxazol-5-yl)methyl]-N-methyl-2-[(2S)-2-methyl-5-oxopyrrolidin-1-yl]acetamide (PubChem CID 97279930) has the molecular formula C14H21N3O3
and a molecular weight of 279.34 g/mol. Its IUPAC name is N-[(3-ethyl-1,2-oxazol-5-yl)methyl]-N-methyl-2-[(2S)-2-methyl-5-oxopyrrolidin-1-yl]acetamide.
Molecular Properties
| Compound Name | N-[(3-ethyl-1,2-oxazol-5-yl)methyl]-N-methyl-2-[(2S)-2-methyl-5-oxopyrrolidin-1-yl]acetamide |
| PubChem CID | 97279930 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-[(3-ethyl-1,2-oxazol-5-yl)methyl]-N-methyl-2-[(2S)-2-methyl-5-oxopyrrolidin-1-yl]acetamide |
| SMILES | CCc1cc(CN(C)C(=O)CN2C(=O)CC[C@@H]2C)on1 |
| InChI | InChI=1S/C14H21N3O3/c1-4-11-7-12(20-15-11)8-16(3)14(19)9-17-10(2)5-6-13(17)18/h7,10H,4-6,8-9H2,1-3H3/t10-/m0/s1 |
| InChIKey | RYDKSMOTHCNGRN-JTQLQIEISA-N |
| XLogP | 1.21 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3-ethyl-1,2-oxazol-5-yl)methyl]-N-methyl-2-[(2S)-2-methyl-5-oxopyrrolidin-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-ethyl-1,2-oxazol-5-yl)methyl]-N-methyl-2-[(2S)-2-methyl-5-oxopyrrolidin-1-yl]acetamide?
The IUPAC name of N-[(3-ethyl-1,2-oxazol-5-yl)methyl]-N-methyl-2-[(2S)-2-methyl-5-oxopyrrolidin-1-yl]acetamide (CID 97279930) is N-[(3-ethyl-1,2-oxazol-5-yl)methyl]-N-methyl-2-[(2S)-2-methyl-5-oxopyrrolidin-1-yl]acetamide.
What is the SMILES notation for N-[(3-ethyl-1,2-oxazol-5-yl)methyl]-N-methyl-2-[(2S)-2-methyl-5-oxopyrrolidin-1-yl]acetamide?
The canonical SMILES for N-[(3-ethyl-1,2-oxazol-5-yl)methyl]-N-methyl-2-[(2S)-2-methyl-5-oxopyrrolidin-1-yl]acetamide is CCc1cc(CN(C)C(=O)CN2C(=O)CC[C@@H]2C)on1.
What is the InChIKey of N-[(3-ethyl-1,2-oxazol-5-yl)methyl]-N-methyl-2-[(2S)-2-methyl-5-oxopyrrolidin-1-yl]acetamide?
The InChIKey is RYDKSMOTHCNGRN-JTQLQIEISA-N. The full InChI is InChI=1S/C14H21N3O3/c1-4-11-7-12(20-15-11)8-16(3)14(19)9-17-10(2)5-6-13(17)18/h7,10H,4-6,8-9H2,1-3H3/t10-/m0/s1.
What are the key properties of N-[(3-ethyl-1,2-oxazol-5-yl)methyl]-N-methyl-2-[(2S)-2-methyl-5-oxopyrrolidin-1-yl]acetamide?
N-[(3-ethyl-1,2-oxazol-5-yl)methyl]-N-methyl-2-[(2S)-2-methyl-5-oxopyrrolidin-1-yl]acetamide has a molecular weight of 279.34 g/mol, XLogP of 1.21, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-ethyl-1,2-oxazol-5-yl)methyl]-N-methyl-2-[(2S)-2-methyl-5-oxopyrrolidin-1-yl]acetamide is sourced from PubChem (CID 97279930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).