C18H22ClN3O3 — CID 97280638
2-[(1R)-2-(4-chloro-3-methylphenoxy)-1-hydroxyethyl]-7,7-dimethyl-1,5,6,8-tetrahydroimidazo[4,5-c]azepin-4-one (PubChem CID 97280638) has the molecular formula C18H22ClN3O3 and a molecular weight of 363.85 g/mol. Its IUPAC name is 2-[(1R)-2-(4-chloro-3-methylphenoxy)-1-hydroxyethyl]-7,7-dimethyl-1,5,6,8-tetrahydroimidazo[4,5-c]azepin-4-one.
| Compound Name | 2-[(1R)-2-(4-chloro-3-methylphenoxy)-1-hydroxyethyl]-7,7-dimethyl-1,5,6,8-tetrahydroimidazo[4,5-c]azepin-4-one |
|---|---|
| PubChem CID | 97280638 |
| Molecular Formula | C18H22ClN3O3 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2-[(1R)-2-(4-chloro-3-methylphenoxy)-1-hydroxyethyl]-7,7-dimethyl-1,5,6,8-tetrahydroimidazo[4,5-c]azepin-4-one |
| SMILES | Cc1cc(OC[C@H](O)c2nc3c([nH]2)CC(C)(C)CNC3=O)ccc1Cl |
| InChI | InChI=1S/C18H22ClN3O3/c1-10-6-11(4-5-12(10)19)25-8-14(23)16-21-13-7-18(2,3)9-20-17(24)15(13)22-16/h4-6,14,23H,7-9H2,1-3H3,(H,20,24)(H,21,22)/t14-/m0/s1 |
| InChIKey | QQBSCDGPLFYTQC-AWEZNQCLSA-N |
| XLogP | 2.80 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |