C17H22N6O — CID 97282072
1-[(2S)-1-imidazol-1-yl-3,3-dimethylbutan-2-yl]-3-(1H-indazol-5-yl)urea (PubChem CID 97282072) has the molecular formula C17H22N6O and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-[(2S)-1-imidazol-1-yl-3,3-dimethylbutan-2-yl]-3-(1H-indazol-5-yl)urea.
| Compound Name | 1-[(2S)-1-imidazol-1-yl-3,3-dimethylbutan-2-yl]-3-(1H-indazol-5-yl)urea |
|---|---|
| PubChem CID | 97282072 |
| Molecular Formula | C17H22N6O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 1-[(2S)-1-imidazol-1-yl-3,3-dimethylbutan-2-yl]-3-(1H-indazol-5-yl)urea |
| SMILES | CC(C)(C)[C@@H](Cn1ccnc1)NC(=O)Nc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C17H22N6O/c1-17(2,3)15(10-23-7-6-18-11-23)21-16(24)20-13-4-5-14-12(8-13)9-19-22-14/h4-9,11,15H,10H2,1-3H3,(H,19,22)(H2,20,21,24)/t15-/m1/s1 |
| InChIKey | DSSFPOUDSRUHEJ-OAHLLOKOSA-N |
| XLogP | 3.00 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |