C11H18N8O — CID 972830
2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N-methylacetamide (PubChem CID 972830) has the molecular formula C11H18N8O and a molecular weight of 278.32 g/mol. Its IUPAC name is 2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N-methylacetamide.
| Compound Name | 2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N-methylacetamide |
|---|---|
| PubChem CID | 972830 |
| Molecular Formula | C11H18N8O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N-methylacetamide |
| SMILES | CNC(=O)CN(C#N)c1nc(N(C)C)nc(N(C)C)n1 |
| InChI | InChI=1S/C11H18N8O/c1-13-8(20)6-19(7-12)11-15-9(17(2)3)14-10(16-11)18(4)5/h6H2,1-5H3,(H,13,20) |
| InChIKey | HOJHITAAFZVURS-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|