About (6S)-4-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-1,4-oxazepan-6-ol
(6S)-4-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-1,4-oxazepan-6-ol (PubChem CID 97283173) has the molecular formula C16H26N4O2
and a molecular weight of 306.41 g/mol. Its IUPAC name is (6S)-4-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-1,4-oxazepan-6-ol.
Molecular Properties
| Compound Name | (6S)-4-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-1,4-oxazepan-6-ol |
| PubChem CID | 97283173 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | (6S)-4-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-1,4-oxazepan-6-ol |
| SMILES | Cc1cc(C)nc(N2CCC(N3CCOC[C@@H](O)C3)CC2)n1 |
| InChI | InChI=1S/C16H26N4O2/c1-12-9-13(2)18-16(17-12)19-5-3-14(4-6-19)20-7-8-22-11-15(21)10-20/h9,14-15,21H,3-8,10-11H2,1-2H3/t15-/m0/s1 |
| InChIKey | GAMVNCLOXRUJMV-HNNXBMFYSA-N |
| XLogP | 0.76 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (6S)-4-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-1,4-oxazepan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-4-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-1,4-oxazepan-6-ol?
The IUPAC name of (6S)-4-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-1,4-oxazepan-6-ol (CID 97283173) is (6S)-4-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-1,4-oxazepan-6-ol.
What is the SMILES notation for (6S)-4-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-1,4-oxazepan-6-ol?
The canonical SMILES for (6S)-4-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-1,4-oxazepan-6-ol is Cc1cc(C)nc(N2CCC(N3CCOC[C@@H](O)C3)CC2)n1.
What is the InChIKey of (6S)-4-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-1,4-oxazepan-6-ol?
The InChIKey is GAMVNCLOXRUJMV-HNNXBMFYSA-N. The full InChI is InChI=1S/C16H26N4O2/c1-12-9-13(2)18-16(17-12)19-5-3-14(4-6-19)20-7-8-22-11-15(21)10-20/h9,14-15,21H,3-8,10-11H2,1-2H3/t15-/m0/s1.
What are the key properties of (6S)-4-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-1,4-oxazepan-6-ol?
(6S)-4-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-1,4-oxazepan-6-ol has a molecular weight of 306.41 g/mol, XLogP of 0.76, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-4-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]-1,4-oxazepan-6-ol is sourced from PubChem (CID 97283173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).