C20H23FN2O3 — CID 97284449
[3-(2-fluorophenoxy)azetidin-1-yl]-[(3S)-1-(furan-2-ylmethyl)piperidin-3-yl]methanone (PubChem CID 97284449) has the molecular formula C20H23FN2O3 and a molecular weight of 358.41 g/mol. Its IUPAC name is [3-(2-fluorophenoxy)azetidin-1-yl]-[(3S)-1-(furan-2-ylmethyl)piperidin-3-yl]methanone.
| Compound Name | [3-(2-fluorophenoxy)azetidin-1-yl]-[(3S)-1-(furan-2-ylmethyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 97284449 |
| Molecular Formula | C20H23FN2O3 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | [3-(2-fluorophenoxy)azetidin-1-yl]-[(3S)-1-(furan-2-ylmethyl)piperidin-3-yl]methanone |
| SMILES | O=C([C@H]1CCCN(Cc2ccco2)C1)N1CC(Oc2ccccc2F)C1 |
| InChI | InChI=1S/C20H23FN2O3/c21-18-7-1-2-8-19(18)26-17-13-23(14-17)20(24)15-5-3-9-22(11-15)12-16-6-4-10-25-16/h1-2,4,6-8,10,15,17H,3,5,9,11-14H2/t15-/m0/s1 |
| InChIKey | CITDKOUCGVEZSD-HNNXBMFYSA-N |
| XLogP | 2.92 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |