C16H29N3O4 — CID 97286758
(6S)-4-[2-(2-methoxyethoxy)acetyl]-1,10-dimethyl-1,4,10-triazaspiro[5.6]dodecan-9-one (PubChem CID 97286758) has the molecular formula C16H29N3O4 and a molecular weight of 327.43 g/mol. Its IUPAC name is (6S)-4-[2-(2-methoxyethoxy)acetyl]-1,10-dimethyl-1,4,10-triazaspiro[5.6]dodecan-9-one.
| Compound Name | (6S)-4-[2-(2-methoxyethoxy)acetyl]-1,10-dimethyl-1,4,10-triazaspiro[5.6]dodecan-9-one |
|---|---|
| PubChem CID | 97286758 |
| Molecular Formula | C16H29N3O4 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | (6S)-4-[2-(2-methoxyethoxy)acetyl]-1,10-dimethyl-1,4,10-triazaspiro[5.6]dodecan-9-one |
| SMILES | COCCOCC(=O)N1CCN(C)[C@]2(CCC(=O)N(C)CC2)C1 |
| InChI | InChI=1S/C16H29N3O4/c1-17-7-6-16(5-4-14(17)20)13-19(9-8-18(16)2)15(21)12-23-11-10-22-3/h4-13H2,1-3H3/t16-/m0/s1 |
| InChIKey | QZBLQLAYFVVKJR-INIZCTEOSA-N |
| XLogP | -0.20 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|