C30H41N3O3S — CID 97286952
2-[2-[4-[(2R)-2-sulfanyl-3-[(1S,5R)-3,3,5-trimethylcyclohexyl]oxypropyl]piperazin-1-yl]ethyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 97286952) has the molecular formula C30H41N3O3S and a molecular weight of 523.74 g/mol. Its IUPAC name is 2-[2-[4-[(2R)-2-sulfanyl-3-[(1S,5R)-3,3,5-trimethylcyclohexyl]oxypropyl]piperazin-1-yl]ethyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[2-[4-[(2R)-2-sulfanyl-3-[(1S,5R)-3,3,5-trimethylcyclohexyl]oxypropyl]piperazin-1-yl]ethyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 97286952 |
| Molecular Formula | C30H41N3O3S |
| Molecular Weight | 523.74 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | 2-[2-[4-[(2R)-2-sulfanyl-3-[(1S,5R)-3,3,5-trimethylcyclohexyl]oxypropyl]piperazin-1-yl]ethyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | C[C@H]1C[C@H](OC[C@H](S)CN2CCN(CCN3C(=O)c4cccc5cccc(c45)C3=O)CC2)CC(C)(C)C1 |
| InChI | InChI=1S/C30H41N3O3S/c1-21-16-23(18-30(2,3)17-21)36-20-24(37)19-32-12-10-31(11-13-32)14-15-33-28(34)25-8-4-6-22-7-5-9-26(27(22)25)29(33)35/h4-9,21,23-24,37H,10-20H2,1-3H3/t21-,23-,24+/m0/s1 |
| InChIKey | ZPMAWOUOEWBKPI-OEMFJLHTSA-N |
| XLogP | 4.58 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.74 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|