C16H14FN5O2 — CID 97287115
(S)-(4-fluorophenyl)-[5-[(4-nitrophenyl)methyl]-1H-1,2,4-triazol-3-yl]methanamine (PubChem CID 97287115) has the molecular formula C16H14FN5O2 and a molecular weight of 327.32 g/mol. Its IUPAC name is (S)-(4-fluorophenyl)-[5-[(4-nitrophenyl)methyl]-1H-1,2,4-triazol-3-yl]methanamine.
| Compound Name | (S)-(4-fluorophenyl)-[5-[(4-nitrophenyl)methyl]-1H-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 97287115 |
| Molecular Formula | C16H14FN5O2 |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | (S)-(4-fluorophenyl)-[5-[(4-nitrophenyl)methyl]-1H-1,2,4-triazol-3-yl]methanamine |
| SMILES | N[C@@H](c1ccc(F)cc1)c1n[nH]c(Cc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C16H14FN5O2/c17-12-5-3-11(4-6-12)15(18)16-19-14(20-21-16)9-10-1-7-13(8-2-10)22(23)24/h1-8,15H,9,18H2,(H,19,20,21)/t15-/m0/s1 |
| InChIKey | GARURNDAUFPKEL-HNNXBMFYSA-N |
| XLogP | 2.49 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|