C16H16N4O — CID 97288602
3-[5-[(1R)-1-amino-2-phenylethyl]-1H-1,2,4-triazol-3-yl]phenol (PubChem CID 97288602) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is 3-[5-[(1R)-1-amino-2-phenylethyl]-1H-1,2,4-triazol-3-yl]phenol.
| Compound Name | 3-[5-[(1R)-1-amino-2-phenylethyl]-1H-1,2,4-triazol-3-yl]phenol |
|---|---|
| PubChem CID | 97288602 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 3-[5-[(1R)-1-amino-2-phenylethyl]-1H-1,2,4-triazol-3-yl]phenol |
| SMILES | N[C@H](Cc1ccccc1)c1nc(-c2cccc(O)c2)n[nH]1 |
| InChI | InChI=1S/C16H16N4O/c17-14(9-11-5-2-1-3-6-11)16-18-15(19-20-16)12-7-4-8-13(21)10-12/h1-8,10,14,21H,9,17H2,(H,18,19,20)/t14-/m1/s1 |
| InChIKey | IOHTVRNCKHTFNG-CQSZACIVSA-N |
| XLogP | 2.42 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |