About 3-[2-(3,4-dimethoxyphenyl)ethyl]-4H-oxadiazol-3-ium-5-imine
3-[2-(3,4-dimethoxyphenyl)ethyl]-4H-oxadiazol-3-ium-5-imine (PubChem CID 97289750) has the molecular formula C12H16N3O3+
and a molecular weight of 250.28 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethyl]-4H-oxadiazol-3-ium-5-imine.
Molecular Properties
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-4H-oxadiazol-3-ium-5-imine |
| PubChem CID | 97289750 |
| Molecular Formula | C12H16N3O3+ |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-4H-oxadiazol-3-ium-5-imine |
| SMILES | [H]/N=C1/C[N+](CCc2ccc(OC)c(OC)c2)=NO1 |
| InChI | InChI=1S/C12H16N3O3/c1-16-10-4-3-9(7-11(10)17-2)5-6-15-8-12(13)18-14-15/h3-4,7,13H,5-6,8H2,1-2H3/q+1/b13-12- |
| InChIKey | MYOSUDVVVGMJAM-SEYXRHQNSA-N |
| XLogP | 1.63 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(3,4-dimethoxyphenyl)ethyl]-4H-oxadiazol-3-ium-5-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3,4-dimethoxyphenyl)ethyl]-4H-oxadiazol-3-ium-5-imine?
The IUPAC name of 3-[2-(3,4-dimethoxyphenyl)ethyl]-4H-oxadiazol-3-ium-5-imine (CID 97289750) is 3-[2-(3,4-dimethoxyphenyl)ethyl]-4H-oxadiazol-3-ium-5-imine.
What is the SMILES notation for 3-[2-(3,4-dimethoxyphenyl)ethyl]-4H-oxadiazol-3-ium-5-imine?
The canonical SMILES for 3-[2-(3,4-dimethoxyphenyl)ethyl]-4H-oxadiazol-3-ium-5-imine is [H]/N=C1/C[N+](CCc2ccc(OC)c(OC)c2)=NO1.
What is the InChIKey of 3-[2-(3,4-dimethoxyphenyl)ethyl]-4H-oxadiazol-3-ium-5-imine?
The InChIKey is MYOSUDVVVGMJAM-SEYXRHQNSA-N. The full InChI is InChI=1S/C12H16N3O3/c1-16-10-4-3-9(7-11(10)17-2)5-6-15-8-12(13)18-14-15/h3-4,7,13H,5-6,8H2,1-2H3/q+1/b13-12-.
What are the key properties of 3-[2-(3,4-dimethoxyphenyl)ethyl]-4H-oxadiazol-3-ium-5-imine?
3-[2-(3,4-dimethoxyphenyl)ethyl]-4H-oxadiazol-3-ium-5-imine has a molecular weight of 250.28 g/mol, XLogP of 1.63, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,4-dimethoxyphenyl)ethyl]-4H-oxadiazol-3-ium-5-imine is sourced from PubChem (CID 97289750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).