About [(S)-[(2S,3S)-1-chloro-2,3-dimethylcyclopropyl]sulfinyl]benzene
[(S)-[(2S,3S)-1-chloro-2,3-dimethylcyclopropyl]sulfinyl]benzene (PubChem CID 97289805) has the molecular formula C11H13ClOS
and a molecular weight of 228.74 g/mol. Its IUPAC name is [(S)-[(2S,3S)-1-chloro-2,3-dimethylcyclopropyl]sulfinyl]benzene.
Molecular Properties
| Compound Name | [(S)-[(2S,3S)-1-chloro-2,3-dimethylcyclopropyl]sulfinyl]benzene |
| PubChem CID | 97289805 |
| Molecular Formula | C11H13ClOS |
| Molecular Weight | 228.74 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | [(S)-[(2S,3S)-1-chloro-2,3-dimethylcyclopropyl]sulfinyl]benzene |
| SMILES | C[C@H]1[C@H](C)C1(Cl)[S@@](=O)c1ccccc1 |
| InChI | InChI=1S/C11H13ClOS/c1-8-9(2)11(8,12)14(13)10-6-4-3-5-7-10/h3-9H,1-2H3/t8-,9-,14-/m0/s1 |
| InChIKey | DRPZLGXYIYMOSV-FZNYLWTLSA-N |
| XLogP | 3.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.74 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [(S)-[(2S,3S)-1-chloro-2,3-dimethylcyclopropyl]sulfinyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(S)-[(2S,3S)-1-chloro-2,3-dimethylcyclopropyl]sulfinyl]benzene?
The IUPAC name of [(S)-[(2S,3S)-1-chloro-2,3-dimethylcyclopropyl]sulfinyl]benzene (CID 97289805) is [(S)-[(2S,3S)-1-chloro-2,3-dimethylcyclopropyl]sulfinyl]benzene.
What is the SMILES notation for [(S)-[(2S,3S)-1-chloro-2,3-dimethylcyclopropyl]sulfinyl]benzene?
The canonical SMILES for [(S)-[(2S,3S)-1-chloro-2,3-dimethylcyclopropyl]sulfinyl]benzene is C[C@H]1[C@H](C)C1(Cl)[S@@](=O)c1ccccc1.
What is the InChIKey of [(S)-[(2S,3S)-1-chloro-2,3-dimethylcyclopropyl]sulfinyl]benzene?
The InChIKey is DRPZLGXYIYMOSV-FZNYLWTLSA-N. The full InChI is InChI=1S/C11H13ClOS/c1-8-9(2)11(8,12)14(13)10-6-4-3-5-7-10/h3-9H,1-2H3/t8-,9-,14-/m0/s1.
What are the key properties of [(S)-[(2S,3S)-1-chloro-2,3-dimethylcyclopropyl]sulfinyl]benzene?
[(S)-[(2S,3S)-1-chloro-2,3-dimethylcyclopropyl]sulfinyl]benzene has a molecular weight of 228.74 g/mol, XLogP of 3.02, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(S)-[(2S,3S)-1-chloro-2,3-dimethylcyclopropyl]sulfinyl]benzene is sourced from PubChem (CID 97289805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).