C5H2Br2F8O — CID 97290831
(1R,2R)-1,2-dibromo-1,2,3,3,3-pentafluoro-1-(2,2,2-trifluoroethoxy)propane (PubChem CID 97290831) has the molecular formula C5H2Br2F8O and a molecular weight of 389.86 g/mol. Its IUPAC name is (1R,2R)-1,2-dibromo-1,2,3,3,3-pentafluoro-1-(2,2,2-trifluoroethoxy)propane.
| Compound Name | (1R,2R)-1,2-dibromo-1,2,3,3,3-pentafluoro-1-(2,2,2-trifluoroethoxy)propane |
|---|---|
| PubChem CID | 97290831 |
| Molecular Formula | C5H2Br2F8O |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 387.83 |
| IUPAC Name | (1R,2R)-1,2-dibromo-1,2,3,3,3-pentafluoro-1-(2,2,2-trifluoroethoxy)propane |
| SMILES | FC(F)(F)CO[C@](F)(Br)[C@](F)(Br)C(F)(F)F |
| InChI | InChI=1S/C5H2Br2F8O/c6-3(11,5(13,14)15)4(7,12)16-1-2(8,9)10/h1H2/t3-,4+/m1/s1 |
| InChIKey | VUXWJSADJYWRST-DMTCNVIQSA-N |
| XLogP | 4.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|